C20H36Si5 — CID 11048006
(4,4,5,5,10,10-hexamethyl-11-trimethylsilyl-4,5,10-trisilabicyclo[6.3.0]undeca-1(11),8-dien-2,6-diyn-9-yl)-trimethylsilane (PubChem CID 11048006) has the molecular formula C20H36Si5 and a molecular weight of 416.94 g/mol. Its IUPAC name is (4,4,5,5,10,10-hexamethyl-11-trimethylsilyl-4,5,10-trisilabicyclo[6.3.0]undeca-1(11),8-dien-2,6-diyn-9-yl)-trimethylsilane.
| Compound Name | (4,4,5,5,10,10-hexamethyl-11-trimethylsilyl-4,5,10-trisilabicyclo[6.3.0]undeca-1(11),8-dien-2,6-diyn-9-yl)-trimethylsilane |
|---|---|
| PubChem CID | 11048006 |
| Molecular Formula | C20H36Si5 |
| Molecular Weight | 416.94 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (4,4,5,5,10,10-hexamethyl-11-trimethylsilyl-4,5,10-trisilabicyclo[6.3.0]undeca-1(11),8-dien-2,6-diyn-9-yl)-trimethylsilane |
| SMILES | C[Si](C)(C)C1=C2C#C[Si](C)(C)[Si](C)(C)C#CC2=C([Si](C)(C)C)[Si]1(C)C |
| InChI | InChI=1S/C20H36Si5/c1-21(2,3)19-17-13-15-23(7,8)24(9,10)16-14-18(17)20(22(4,5)6)25(19,11)12/h1-12H3 |
| InChIKey | FJIAXSVFNGYSCR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.94 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|