C34H62Si7 — CID 100947594
trimethyl-[4,4,9,9-tetraethyl-14,14-dimethyl-5,8,15-tris(trimethylsilyl)-4,9,14-trisilabicyclo[10.3.0]pentadeca-1(15),5,6,7,12-pentaen-2,10-diyn-13-yl]silane (PubChem CID 100947594) has the molecular formula C34H62Si7 and a molecular weight of 667.47 g/mol. Its IUPAC name is trimethyl-[4,4,9,9-tetraethyl-14,14-dimethyl-5,8,15-tris(trimethylsilyl)-4,9,14-trisilabicyclo[10.3.0]pentadeca-1(15),5,6,7,12-pentaen-2,10-diyn-13-yl]silane.
| Compound Name | trimethyl-[4,4,9,9-tetraethyl-14,14-dimethyl-5,8,15-tris(trimethylsilyl)-4,9,14-trisilabicyclo[10.3.0]pentadeca-1(15),5,6,7,12-pentaen-2,10-diyn-13-yl]silane |
|---|---|
| PubChem CID | 100947594 |
| Molecular Formula | C34H62Si7 |
| Molecular Weight | 667.47 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | trimethyl-[4,4,9,9-tetraethyl-14,14-dimethyl-5,8,15-tris(trimethylsilyl)-4,9,14-trisilabicyclo[10.3.0]pentadeca-1(15),5,6,7,12-pentaen-2,10-diyn-13-yl]silane |
| SMILES | CC[Si]1(CC)C#CC2=C([Si](C)(C)C)[Si](C)(C)C([Si](C)(C)C)=C2C#C[Si](CC)(CC)C([Si](C)(C)C)=C=C=C1[Si](C)(C)C |
| InChI | InChI=1S/C34H62Si7/c1-19-40(20-2)27-25-29-30(34(38(14,15)16)39(17,18)33(29)37(11,12)13)26-28-41(21-3,22-4)32(36(8,9)10)24-23-31(40)35(5,6)7/h19-22H2,1-18H3/b32-31- |
| InChIKey | SBHNQBWKVHOCMN-MVJHLKBCSA-N |
| XLogP | 10.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.47 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|