C16H34Si3 — CID 54445215
(1,1-diethyl-3,4-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane (PubChem CID 54445215) has the molecular formula C16H34Si3 and a molecular weight of 310.71 g/mol. Its IUPAC name is (1,1-diethyl-3,4-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane.
| Compound Name | (1,1-diethyl-3,4-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 54445215 |
| Molecular Formula | C16H34Si3 |
| Molecular Weight | 310.71 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (1,1-diethyl-3,4-dimethyl-5-trimethylsilylsilol-2-yl)-trimethylsilane |
| SMILES | CC[Si]1(CC)C([Si](C)(C)C)=C(C)C(C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C16H34Si3/c1-11-19(12-2)15(17(5,6)7)13(3)14(4)16(19)18(8,9)10/h11-12H2,1-10H3 |
| InChIKey | WQZRQMQEPLCOCW-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.71 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|