C18H40Si4 — CID 54397224
ethyl-[4-ethyl-1,1-dimethyl-2,5-bis(trimethylsilyl)silol-3-yl]-dimethylsilane (PubChem CID 54397224) has the molecular formula C18H40Si4 and a molecular weight of 368.86 g/mol. Its IUPAC name is ethyl-[4-ethyl-1,1-dimethyl-2,5-bis(trimethylsilyl)silol-3-yl]-dimethylsilane.
| Compound Name | ethyl-[4-ethyl-1,1-dimethyl-2,5-bis(trimethylsilyl)silol-3-yl]-dimethylsilane |
|---|---|
| PubChem CID | 54397224 |
| Molecular Formula | C18H40Si4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | ethyl-[4-ethyl-1,1-dimethyl-2,5-bis(trimethylsilyl)silol-3-yl]-dimethylsilane |
| SMILES | CCC1=C([Si](C)(C)C)[Si](C)(C)C([Si](C)(C)C)=C1[Si](C)(C)CC |
| InChI | InChI=1S/C18H40Si4/c1-13-15-16(21(9,10)14-2)18(20(6,7)8)22(11,12)17(15)19(3,4)5/h13-14H2,1-12H3 |
| InChIKey | VKVTZHOLPVZYIR-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|