C16H34Si2 — CID 10540900
trimethyl-[2-methyl-4-(trimethylsilylmethyl)octa-2,3-dienyl]silane (PubChem CID 10540900) has the molecular formula C16H34Si2 and a molecular weight of 282.62 g/mol. Its IUPAC name is trimethyl-[2-methyl-4-(trimethylsilylmethyl)octa-2,3-dienyl]silane.
| Compound Name | trimethyl-[2-methyl-4-(trimethylsilylmethyl)octa-2,3-dienyl]silane |
|---|---|
| PubChem CID | 10540900 |
| Molecular Formula | C16H34Si2 |
| Molecular Weight | 282.62 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | trimethyl-[2-methyl-4-(trimethylsilylmethyl)octa-2,3-dienyl]silane |
| SMILES | CCCCC(=C=C(C)C[Si](C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C16H34Si2/c1-9-10-11-16(14-18(6,7)8)12-15(2)13-17(3,4)5/h9-11,13-14H2,1-8H3 |
| InChIKey | HBJZZWBLOBCEOX-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|