C18H38Si2 — CID 23630571
trimethyl-[(2E,6E)-2,3,6,7-tetramethyl-8-trimethylsilylocta-2,6-dienyl]silane (PubChem CID 23630571) has the molecular formula C18H38Si2 and a molecular weight of 310.67 g/mol. Its IUPAC name is trimethyl-[(2E,6E)-2,3,6,7-tetramethyl-8-trimethylsilylocta-2,6-dienyl]silane.
| Compound Name | trimethyl-[(2E,6E)-2,3,6,7-tetramethyl-8-trimethylsilylocta-2,6-dienyl]silane |
|---|---|
| PubChem CID | 23630571 |
| Molecular Formula | C18H38Si2 |
| Molecular Weight | 310.67 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | trimethyl-[(2E,6E)-2,3,6,7-tetramethyl-8-trimethylsilylocta-2,6-dienyl]silane |
| SMILES | C/C(CC/C(C)=C(\C)C[Si](C)(C)C)=C(/C)C[Si](C)(C)C |
| InChI | InChI=1S/C18H38Si2/c1-15(17(3)13-19(5,6)7)11-12-16(2)18(4)14-20(8,9)10/h11-14H2,1-10H3/b17-15+,18-16+ |
| InChIKey | IPLWGPGYAFJIBI-YTEMWHBBSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.67 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|