C16H34Si2 — CID 13234485
[(2E,6E)-3,6-dimethyl-8-trimethylsilylocta-2,6-dienyl]-trimethylsilane (PubChem CID 13234485) has the molecular formula C16H34Si2 and a molecular weight of 282.62 g/mol. Its IUPAC name is [(2E,6E)-3,6-dimethyl-8-trimethylsilylocta-2,6-dienyl]-trimethylsilane.
| Compound Name | [(2E,6E)-3,6-dimethyl-8-trimethylsilylocta-2,6-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 13234485 |
| Molecular Formula | C16H34Si2 |
| Molecular Weight | 282.62 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | [(2E,6E)-3,6-dimethyl-8-trimethylsilylocta-2,6-dienyl]-trimethylsilane |
| SMILES | C/C(=C\C[Si](C)(C)C)CC/C(C)=C/C[Si](C)(C)C |
| InChI | InChI=1S/C16H34Si2/c1-15(11-13-17(3,4)5)9-10-16(2)12-14-18(6,7)8/h11-12H,9-10,13-14H2,1-8H3/b15-11+,16-12+ |
| InChIKey | HBBDRNTWFXRSFI-JOBJLJCHSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.62 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|