C31H54Si — CID 14227308
dimethyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-[(1E,5E)-2,6,10-trimethylundeca-1,5,9-trienyl]silane (PubChem CID 14227308) has the molecular formula C31H54Si and a molecular weight of 454.86 g/mol. Its IUPAC name is dimethyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-[(1E,5E)-2,6,10-trimethylundeca-1,5,9-trienyl]silane.
| Compound Name | dimethyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-[(1E,5E)-2,6,10-trimethylundeca-1,5,9-trienyl]silane |
|---|---|
| PubChem CID | 14227308 |
| Molecular Formula | C31H54Si |
| Molecular Weight | 454.86 g/mol |
| Exact Mass | 454.40 |
| IUPAC Name | dimethyl-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-[(1E,5E)-2,6,10-trimethylundeca-1,5,9-trienyl]silane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C[Si](C)(C)/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C31H54Si/c1-26(2)15-11-17-28(5)19-13-21-30(7)23-24-32(9,10)25-31(8)22-14-20-29(6)18-12-16-27(3)4/h15-16,19-20,23,25H,11-14,17-18,21-22,24H2,1-10H3/b28-19+,29-20+,30-23+,31-25+ |
| InChIKey | LRQAZAWNSYHVPT-XISNVFLFSA-N |
| XLogP | 11.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.86 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|