C24H48GeSi4 — CID 154716235
[3,8-diethyl-1,4,6-tris(trimethylsilyl)-5-germaspiro[4.4]nona-1,3,6,8-tetraen-9-yl]-trimethylsilane (PubChem CID 154716235) has the molecular formula C24H48GeSi4 and a molecular weight of 521.60 g/mol. Its IUPAC name is [3,8-diethyl-1,4,6-tris(trimethylsilyl)-5-germaspiro[4.4]nona-1,3,6,8-tetraen-9-yl]-trimethylsilane.
| Compound Name | [3,8-diethyl-1,4,6-tris(trimethylsilyl)-5-germaspiro[4.4]nona-1,3,6,8-tetraen-9-yl]-trimethylsilane |
|---|---|
| PubChem CID | 154716235 |
| Molecular Formula | C24H48GeSi4 |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | [3,8-diethyl-1,4,6-tris(trimethylsilyl)-5-germaspiro[4.4]nona-1,3,6,8-tetraen-9-yl]-trimethylsilane |
| SMILES | CCC1=C([Si](C)(C)C)[Ge]2(C([Si](C)(C)C)=C1)C([Si](C)(C)C)=CC(CC)=C2[Si](C)(C)C |
| InChI | InChI=1S/C24H48GeSi4/c1-15-19-17-21(26(3,4)5)25(23(19)28(9,10)11)22(27(6,7)8)18-20(16-2)24(25)29(12,13)14/h17-18H,15-16H2,1-14H3 |
| InChIKey | AKKAVCGJFNNBLY-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|