C24H51BSi2Sn — CID 154716772
(1,1-dibutyl-3-diethylboranyl-4-ethyl-5-trimethylsilylstannol-2-yl)-trimethylsilane (PubChem CID 154716772) has the molecular formula C24H51BSi2Sn and a molecular weight of 525.37 g/mol. Its IUPAC name is (1,1-dibutyl-3-diethylboranyl-4-ethyl-5-trimethylsilylstannol-2-yl)-trimethylsilane.
| Compound Name | (1,1-dibutyl-3-diethylboranyl-4-ethyl-5-trimethylsilylstannol-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 154716772 |
| Molecular Formula | C24H51BSi2Sn |
| Molecular Weight | 525.37 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | (1,1-dibutyl-3-diethylboranyl-4-ethyl-5-trimethylsilylstannol-2-yl)-trimethylsilane |
| SMILES | CCCC[Sn]1(CCCC)C([Si](C)(C)C)=C(CC)C(B(CC)CC)=C1[Si](C)(C)C |
| InChI | InChI=1S/C16H33BSi2.2C4H9.Sn/c1-10-15(13-18(4,5)6)16(14-19(7,8)9)17(11-2)12-3;2*1-3-4-2;/h10-12H2,1-9H3;2*1,3-4H2,2H3; |
| InChIKey | APLZIYIAVSINCR-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.37 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|