C32H66B2Si3Sn2 — CID 15495132
bis(3-diethylboranyl-4-ethyl-1,1-dimethyl-5-trimethylstannylsilol-2-yl)-dimethylsilane (PubChem CID 15495132) has the molecular formula C32H66B2Si3Sn2 and a molecular weight of 794.18 g/mol. Its IUPAC name is bis(3-diethylboranyl-4-ethyl-1,1-dimethyl-5-trimethylstannylsilol-2-yl)-dimethylsilane.
| Compound Name | bis(3-diethylboranyl-4-ethyl-1,1-dimethyl-5-trimethylstannylsilol-2-yl)-dimethylsilane |
|---|---|
| PubChem CID | 15495132 |
| Molecular Formula | C32H66B2Si3Sn2 |
| Molecular Weight | 794.18 g/mol |
| Exact Mass | 796.27 |
| IUPAC Name | bis(3-diethylboranyl-4-ethyl-1,1-dimethyl-5-trimethylstannylsilol-2-yl)-dimethylsilane |
| SMILES | CCB(CC)C1=C([Si](C)(C)C2=C(B(CC)CC)C(CC)=C([Sn](C)(C)C)[Si]2(C)C)[Si](C)(C)C([Sn](C)(C)C)=C1CC |
| InChI | InChI=1S/C26H48B2Si3.6CH3.2Sn/c1-13-21-19-29(7,8)25(23(21)27(15-3)16-4)31(11,12)26-24(28(17-5)18-6)22(14-2)20-30(26,9)10;;;;;;;;/h13-18H2,1-12H3;6*1H3;; |
| InChIKey | KCONAMKZQJWGHC-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.18 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|