C34H66B2Si2Sn — CID 15495138
bis(5-tert-butyl-4-diethylboranyl-3-ethyl-1,1-dimethylsilol-2-yl)-dimethylstannane (PubChem CID 15495138) has the molecular formula C34H66B2Si2Sn and a molecular weight of 671.41 g/mol. Its IUPAC name is bis(5-tert-butyl-4-diethylboranyl-3-ethyl-1,1-dimethylsilol-2-yl)-dimethylstannane.
| Compound Name | bis(5-tert-butyl-4-diethylboranyl-3-ethyl-1,1-dimethylsilol-2-yl)-dimethylstannane |
|---|---|
| PubChem CID | 15495138 |
| Molecular Formula | C34H66B2Si2Sn |
| Molecular Weight | 671.41 g/mol |
| Exact Mass | 672.39 |
| IUPAC Name | bis(5-tert-butyl-4-diethylboranyl-3-ethyl-1,1-dimethylsilol-2-yl)-dimethylstannane |
| SMILES | CCB(CC)C1=C(C(C)(C)C)[Si](C)(C)C([Sn](C)(C)C2=C(CC)C(B(CC)CC)=C(C(C)(C)C)[Si]2(C)C)=C1CC |
| InChI | InChI=1S/2C16H30BSi.2CH3.Sn/c2*1-9-13-12-18(7,8)15(16(4,5)6)14(13)17(10-2)11-3;;;/h2*9-11H2,1-8H3;2*1H3; |
| InChIKey | PXWYZSOKKNBDJH-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.41 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|