C19H39BSiSn — CID 634330
(5-tert-butyl-4-diethylboranyl-3-ethyl-1,1-dimethylsilol-2-yl)-trimethylstannane (PubChem CID 634330) has the molecular formula C19H39BSiSn and a molecular weight of 425.13 g/mol. Its IUPAC name is (5-tert-butyl-4-diethylboranyl-3-ethyl-1,1-dimethylsilol-2-yl)-trimethylstannane.
| Compound Name | (5-tert-butyl-4-diethylboranyl-3-ethyl-1,1-dimethylsilol-2-yl)-trimethylstannane |
|---|---|
| PubChem CID | 634330 |
| Molecular Formula | C19H39BSiSn |
| Molecular Weight | 425.13 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (5-tert-butyl-4-diethylboranyl-3-ethyl-1,1-dimethylsilol-2-yl)-trimethylstannane |
| SMILES | CCB(CC)C1=C(C(C)(C)C)[Si](C)(C)C([Sn](C)(C)C)=C1CC |
| InChI | InChI=1S/C16H30BSi.3CH3.Sn/c1-9-13-12-18(7,8)15(16(4,5)6)14(13)17(10-2)11-3;;;;/h9-11H2,1-8H3;3*1H3; |
| InChIKey | YDWURDIRMSSJAP-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.13 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|