C20H39BSi — CID 15151071
(2,5-dibutyl-4-ethyl-1,1-dimethylsilol-3-yl)-diethylborane (PubChem CID 15151071) has the molecular formula C20H39BSi and a molecular weight of 318.43 g/mol. Its IUPAC name is (2,5-dibutyl-4-ethyl-1,1-dimethylsilol-3-yl)-diethylborane.
| Compound Name | (2,5-dibutyl-4-ethyl-1,1-dimethylsilol-3-yl)-diethylborane |
|---|---|
| PubChem CID | 15151071 |
| Molecular Formula | C20H39BSi |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | (2,5-dibutyl-4-ethyl-1,1-dimethylsilol-3-yl)-diethylborane |
| SMILES | CCCCC1=C(CC)C(B(CC)CC)=C(CCCC)[Si]1(C)C |
| InChI | InChI=1S/C20H39BSi/c1-8-13-15-18-17(10-3)20(21(11-4)12-5)19(16-14-9-2)22(18,6)7/h8-16H2,1-7H3 |
| InChIKey | HTHKHBUNEDKJQO-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|