C18H38Si3 — CID 15329687
trimethyl-(2,3,4,5-tetraethyl-1-trimethylsilylsilol-1-yl)silane (PubChem CID 15329687) has the molecular formula C18H38Si3 and a molecular weight of 338.76 g/mol. Its IUPAC name is trimethyl-(2,3,4,5-tetraethyl-1-trimethylsilylsilol-1-yl)silane.
| Compound Name | trimethyl-(2,3,4,5-tetraethyl-1-trimethylsilylsilol-1-yl)silane |
|---|---|
| PubChem CID | 15329687 |
| Molecular Formula | C18H38Si3 |
| Molecular Weight | 338.76 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | trimethyl-(2,3,4,5-tetraethyl-1-trimethylsilylsilol-1-yl)silane |
| SMILES | CCC1=C(CC)[Si]([Si](C)(C)C)([Si](C)(C)C)C(CC)=C1CC |
| InChI | InChI=1S/C18H38Si3/c1-11-15-16(12-2)18(14-4)21(17(15)13-3,19(5,6)7)20(8,9)10/h11-14H2,1-10H3 |
| InChIKey | JHIDXXBNERMJOP-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.76 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|