C22H42Si4 — CID 15329682
trimethyl-[2,3,4,5-tetramethyl-1-(2,3,4,5-tetramethyl-1-trimethylsilylsilol-1-yl)silol-1-yl]silane (PubChem CID 15329682) has the molecular formula C22H42Si4 and a molecular weight of 418.92 g/mol. Its IUPAC name is trimethyl-[2,3,4,5-tetramethyl-1-(2,3,4,5-tetramethyl-1-trimethylsilylsilol-1-yl)silol-1-yl]silane.
| Compound Name | trimethyl-[2,3,4,5-tetramethyl-1-(2,3,4,5-tetramethyl-1-trimethylsilylsilol-1-yl)silol-1-yl]silane |
|---|---|
| PubChem CID | 15329682 |
| Molecular Formula | C22H42Si4 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | trimethyl-[2,3,4,5-tetramethyl-1-(2,3,4,5-tetramethyl-1-trimethylsilylsilol-1-yl)silol-1-yl]silane |
| SMILES | CC1=C(C)[Si]([Si](C)(C)C)([Si]2([Si](C)(C)C)C(C)=C(C)C(C)=C2C)C(C)=C1C |
| InChI | InChI=1S/C22H42Si4/c1-15-16(2)20(6)25(19(15)5,23(9,10)11)26(24(12,13)14)21(7)17(3)18(4)22(26)8/h1-14H3 |
| InChIKey | ZMRMOMIHNGPJGV-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|