C20H32Si — CID 15861639
dimethyl-bis(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 15861639) has the molecular formula C20H32Si and a molecular weight of 300.56 g/mol. Its IUPAC name is dimethyl-bis(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | dimethyl-bis(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 15861639 |
| Molecular Formula | C20H32Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | dimethyl-bis(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)C([Si](C)(C)C2=C(C)C(C)=C(C)C2C)=C1C |
| InChI | InChI=1S/C20H32Si/c1-11-12(2)16(6)19(15(11)5)21(9,10)20-17(7)13(3)14(4)18(20)8/h15,17H,1-10H3 |
| InChIKey | NEDWKTJMDHHTCW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|