C22H43BSi — CID 15151073
diethyl-[4-ethyl-1,1-dimethyl-2,5-bis(3-methylbutyl)silol-3-yl]borane (PubChem CID 15151073) has the molecular formula C22H43BSi and a molecular weight of 346.48 g/mol. Its IUPAC name is diethyl-[4-ethyl-1,1-dimethyl-2,5-bis(3-methylbutyl)silol-3-yl]borane.
| Compound Name | diethyl-[4-ethyl-1,1-dimethyl-2,5-bis(3-methylbutyl)silol-3-yl]borane |
|---|---|
| PubChem CID | 15151073 |
| Molecular Formula | C22H43BSi |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | diethyl-[4-ethyl-1,1-dimethyl-2,5-bis(3-methylbutyl)silol-3-yl]borane |
| SMILES | CCB(CC)C1=C(CCC(C)C)[Si](C)(C)C(CCC(C)C)=C1CC |
| InChI | InChI=1S/C22H43BSi/c1-10-19-20(15-13-17(4)5)24(8,9)21(16-14-18(6)7)22(19)23(11-2)12-3/h17-18H,10-16H2,1-9H3 |
| InChIKey | JNROGXYPLCIHFB-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|