C24H40Si — CID 139672577
diethyl-bis(4-ethyl-2-propan-2-ylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 139672577) has the molecular formula C24H40Si and a molecular weight of 356.67 g/mol. Its IUPAC name is diethyl-bis(4-ethyl-2-propan-2-ylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | diethyl-bis(4-ethyl-2-propan-2-ylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 139672577 |
| Molecular Formula | C24H40Si |
| Molecular Weight | 356.67 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | diethyl-bis(4-ethyl-2-propan-2-ylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CCC1=CC([Si](CC)(CC)C2C=C(CC)C=C2C(C)C)C(C(C)C)=C1 |
| InChI | InChI=1S/C24H40Si/c1-9-19-13-21(17(5)6)23(15-19)25(11-3,12-4)24-16-20(10-2)14-22(24)18(7)8/h13-18,23-24H,9-12H2,1-8H3 |
| InChIKey | ZTODQIFPFRURGV-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.67 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|