C20H40Si3 — CID 553322
2-bicyclo[2.2.1]hepta-2,5-dienyl-methyl-bis(3-trimethylsilylpropyl)silane (PubChem CID 553322) has the molecular formula C20H40Si3 and a molecular weight of 364.80 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hepta-2,5-dienyl-methyl-bis(3-trimethylsilylpropyl)silane.
| Compound Name | 2-bicyclo[2.2.1]hepta-2,5-dienyl-methyl-bis(3-trimethylsilylpropyl)silane |
|---|---|
| PubChem CID | 553322 |
| Molecular Formula | C20H40Si3 |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 2-bicyclo[2.2.1]hepta-2,5-dienyl-methyl-bis(3-trimethylsilylpropyl)silane |
| SMILES | C[Si](C)(C)CCC[Si](C)(CCC[Si](C)(C)C)C1=CC2C=CC1C2 |
| InChI | InChI=1S/C20H40Si3/c1-21(2,3)12-8-14-23(7,15-9-13-22(4,5)6)20-17-18-10-11-19(20)16-18/h10-11,17-19H,8-9,12-16H2,1-7H3 |
| InChIKey | ZYVSWXOBWTYCDA-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|