C17H32Si2 — CID 553227
(2,4-dimethyl-6-prop-1-en-2-yl-3-trimethylsilylcyclohexa-1,4-dien-1-yl)-trimethylsilane (PubChem CID 553227) has the molecular formula C17H32Si2 and a molecular weight of 292.62 g/mol. Its IUPAC name is (2,4-dimethyl-6-prop-1-en-2-yl-3-trimethylsilylcyclohexa-1,4-dien-1-yl)-trimethylsilane.
| Compound Name | (2,4-dimethyl-6-prop-1-en-2-yl-3-trimethylsilylcyclohexa-1,4-dien-1-yl)-trimethylsilane |
|---|---|
| PubChem CID | 553227 |
| Molecular Formula | C17H32Si2 |
| Molecular Weight | 292.62 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (2,4-dimethyl-6-prop-1-en-2-yl-3-trimethylsilylcyclohexa-1,4-dien-1-yl)-trimethylsilane |
| SMILES | C=C(C)C1C=C(C)C([Si](C)(C)C)C(C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C17H32Si2/c1-12(2)15-11-13(3)16(18(5,6)7)14(4)17(15)19(8,9)10/h11,15-16H,1H2,2-10H3 |
| InChIKey | OMTSOOOYBCPOSR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|