C16H30Si2 — CID 15339738
(5-ethenyl-2,3-dimethyl-4-trimethylsilylcyclohexa-1,3-dien-1-yl)-trimethylsilane (PubChem CID 15339738) has the molecular formula C16H30Si2 and a molecular weight of 278.59 g/mol. Its IUPAC name is (5-ethenyl-2,3-dimethyl-4-trimethylsilylcyclohexa-1,3-dien-1-yl)-trimethylsilane.
| Compound Name | (5-ethenyl-2,3-dimethyl-4-trimethylsilylcyclohexa-1,3-dien-1-yl)-trimethylsilane |
|---|---|
| PubChem CID | 15339738 |
| Molecular Formula | C16H30Si2 |
| Molecular Weight | 278.59 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (5-ethenyl-2,3-dimethyl-4-trimethylsilylcyclohexa-1,3-dien-1-yl)-trimethylsilane |
| SMILES | C=CC1CC([Si](C)(C)C)=C(C)C(C)=C1[Si](C)(C)C |
| InChI | InChI=1S/C16H30Si2/c1-10-14-11-15(17(4,5)6)12(2)13(3)16(14)18(7,8)9/h10,14H,1,11H2,2-9H3 |
| InChIKey | GEENVWZKJDENII-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|