C19H29Si+ — CID 146163039
[(3E,6E)-6-cyclohexa-2,4-dien-1-ylidene-3-methylhexa-1,3-dien-2-yl]-triethylsilane (PubChem CID 146163039) has the molecular formula C19H29Si+ and a molecular weight of 285.53 g/mol. Its IUPAC name is [(3E,6E)-6-cyclohexa-2,4-dien-1-ylidene-3-methylhexa-1,3-dien-2-yl]-triethylsilane.
| Compound Name | [(3E,6E)-6-cyclohexa-2,4-dien-1-ylidene-3-methylhexa-1,3-dien-2-yl]-triethylsilane |
|---|---|
| PubChem CID | 146163039 |
| Molecular Formula | C19H29Si+ |
| Molecular Weight | 285.53 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | [(3E,6E)-6-cyclohexa-2,4-dien-1-ylidene-3-methylhexa-1,3-dien-2-yl]-triethylsilane |
| SMILES | C=C(/C(C)=C/C/C=C1/C=CC=C[CH+]1)[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H29Si/c1-6-20(7-2,8-3)18(5)17(4)13-12-16-19-14-10-9-11-15-19/h9-11,13-16H,5-8,12H2,1-4H3/q+1/b17-13+ |
| InChIKey | KHNUAJYXYQYEFQ-GHRIWEEISA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|