C11H22Si — CID 102473316
[(2E)-4,5-dimethylhexa-2,4-dienyl]-trimethylsilane (PubChem CID 102473316) has the molecular formula C11H22Si and a molecular weight of 182.38 g/mol. Its IUPAC name is [(2E)-4,5-dimethylhexa-2,4-dienyl]-trimethylsilane.
| Compound Name | [(2E)-4,5-dimethylhexa-2,4-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 102473316 |
| Molecular Formula | C11H22Si |
| Molecular Weight | 182.38 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | [(2E)-4,5-dimethylhexa-2,4-dienyl]-trimethylsilane |
| SMILES | CC(C)=C(C)/C=C/C[Si](C)(C)C |
| InChI | InChI=1S/C11H22Si/c1-10(2)11(3)8-7-9-12(4,5)6/h7-8H,9H2,1-6H3/b8-7+ |
| InChIKey | JWAVYGYWYCCGEU-BQYQJAHWSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|