C13H24Si — CID 642580
[(6E)-2,2-dimethylocta-3,4,6-trien-3-yl]-trimethylsilane (PubChem CID 642580) has the molecular formula C13H24Si and a molecular weight of 208.42 g/mol. Its IUPAC name is [(6E)-2,2-dimethylocta-3,4,6-trien-3-yl]-trimethylsilane.
| Compound Name | [(6E)-2,2-dimethylocta-3,4,6-trien-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 642580 |
| Molecular Formula | C13H24Si |
| Molecular Weight | 208.42 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | [(6E)-2,2-dimethylocta-3,4,6-trien-3-yl]-trimethylsilane |
| SMILES | C/C=C/C=C=C(C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H24Si/c1-8-9-10-11-12(13(2,3)4)14(5,6)7/h8-10H,1-7H3/b9-8+ |
| InChIKey | AOVNXGZIEAPCKB-CMDGGOBGSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|