C10H22Si — CID 13215156
[(Z)-4,4-dimethylpent-2-enyl]-trimethylsilane (PubChem CID 13215156) has the molecular formula C10H22Si and a molecular weight of 170.37 g/mol. Its IUPAC name is [(Z)-4,4-dimethylpent-2-enyl]-trimethylsilane.
| Compound Name | [(Z)-4,4-dimethylpent-2-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 13215156 |
| Molecular Formula | C10H22Si |
| Molecular Weight | 170.37 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | [(Z)-4,4-dimethylpent-2-enyl]-trimethylsilane |
| SMILES | CC(C)(C)/C=C\C[Si](C)(C)C |
| InChI | InChI=1S/C10H22Si/c1-10(2,3)8-7-9-11(4,5)6/h7-8H,9H2,1-6H3/b8-7- |
| InChIKey | RMDGQGZJWUDYED-FPLPWBNLSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|