C11H22Si — CID 5366375
trimethyl-[(2E,6E)-octa-2,6-dienyl]silane (PubChem CID 5366375) has the molecular formula C11H22Si and a molecular weight of 182.38 g/mol. Its IUPAC name is trimethyl-[(2E,6E)-octa-2,6-dienyl]silane.
| Compound Name | trimethyl-[(2E,6E)-octa-2,6-dienyl]silane |
|---|---|
| PubChem CID | 5366375 |
| Molecular Formula | C11H22Si |
| Molecular Weight | 182.38 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | trimethyl-[(2E,6E)-octa-2,6-dienyl]silane |
| SMILES | C/C=C/CC/C=C/C[Si](C)(C)C |
| InChI | InChI=1S/C11H22Si/c1-5-6-7-8-9-10-11-12(2,3)4/h5-6,9-10H,7-8,11H2,1-4H3/b6-5+,10-9+ |
| InChIKey | UMZOZQSDOLSLHM-QPHGKBKNSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|