C10H20Si — CID 5366644
trimethyl-[(3E)-2-methylhexa-1,3-dien-3-yl]silane (PubChem CID 5366644) has the molecular formula C10H20Si and a molecular weight of 168.36 g/mol. Its IUPAC name is trimethyl-[(3E)-2-methylhexa-1,3-dien-3-yl]silane.
| Compound Name | trimethyl-[(3E)-2-methylhexa-1,3-dien-3-yl]silane |
|---|---|
| PubChem CID | 5366644 |
| Molecular Formula | C10H20Si |
| Molecular Weight | 168.36 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | trimethyl-[(3E)-2-methylhexa-1,3-dien-3-yl]silane |
| SMILES | C=C(C)/C(=C\CC)[Si](C)(C)C |
| InChI | InChI=1S/C10H20Si/c1-7-8-10(9(2)3)11(4,5)6/h8H,2,7H2,1,3-6H3/b10-8+ |
| InChIKey | YCKKTGCJKIFLEE-CSKARUKUSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|