C15H31BSi — CID 14436725
[(4E)-5-diethylboranyl-2-methylhepta-2,4-dien-4-yl]-trimethylsilane (PubChem CID 14436725) has the molecular formula C15H31BSi and a molecular weight of 250.31 g/mol. Its IUPAC name is [(4E)-5-diethylboranyl-2-methylhepta-2,4-dien-4-yl]-trimethylsilane.
| Compound Name | [(4E)-5-diethylboranyl-2-methylhepta-2,4-dien-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 14436725 |
| Molecular Formula | C15H31BSi |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | [(4E)-5-diethylboranyl-2-methylhepta-2,4-dien-4-yl]-trimethylsilane |
| SMILES | CCB(CC)/C(CC)=C(/C=C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C15H31BSi/c1-9-14(16(10-2)11-3)15(12-13(4)5)17(6,7)8/h12H,9-11H2,1-8H3/b15-14- |
| InChIKey | DXLRNPOARCASPO-PFONDFGASA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|