C14H29BSi — CID 5366556
[(3E)-4-diethylboranyl-2-methylhexa-1,3-dien-3-yl]-trimethylsilane (PubChem CID 5366556) has the molecular formula C14H29BSi and a molecular weight of 236.28 g/mol. Its IUPAC name is [(3E)-4-diethylboranyl-2-methylhexa-1,3-dien-3-yl]-trimethylsilane.
| Compound Name | [(3E)-4-diethylboranyl-2-methylhexa-1,3-dien-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 5366556 |
| Molecular Formula | C14H29BSi |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | [(3E)-4-diethylboranyl-2-methylhexa-1,3-dien-3-yl]-trimethylsilane |
| SMILES | C=C(C)/C(=C(\CC)B(CC)CC)[Si](C)(C)C |
| InChI | InChI=1S/C14H29BSi/c1-9-13(15(10-2)11-3)14(12(4)5)16(6,7)8/h4,9-11H2,1-3,5-8H3/b14-13- |
| InChIKey | QMWDWIHSRCBAJG-YPKPFQOOSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|