C18H34Si2 — CID 11781753
[(4E,6E)-5,6-dimethyl-7-trimethylsilyldeca-1,4,6,9-tetraen-4-yl]-trimethylsilane (PubChem CID 11781753) has the molecular formula C18H34Si2 and a molecular weight of 306.64 g/mol. Its IUPAC name is [(4E,6E)-5,6-dimethyl-7-trimethylsilyldeca-1,4,6,9-tetraen-4-yl]-trimethylsilane.
| Compound Name | [(4E,6E)-5,6-dimethyl-7-trimethylsilyldeca-1,4,6,9-tetraen-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 11781753 |
| Molecular Formula | C18H34Si2 |
| Molecular Weight | 306.64 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | [(4E,6E)-5,6-dimethyl-7-trimethylsilyldeca-1,4,6,9-tetraen-4-yl]-trimethylsilane |
| SMILES | C=CC/C(=C(C)\C(C)=C(/CC=C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H34Si2/c1-11-13-17(19(5,6)7)15(3)16(4)18(14-12-2)20(8,9)10/h11-12H,1-2,13-14H2,3-10H3/b17-15+,18-16+ |
| InChIKey | YHJVBJNOIAKEGO-YTEMWHBBSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.64 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|