C24H50Si5 — CID 101175020
[7,10-dimethyl-1,4,4-tris(trimethylsilyl)-5-silaspiro[4.6]undeca-6,8,10-trien-1-yl]-trimethylsilane (PubChem CID 101175020) has the molecular formula C24H50Si5 and a molecular weight of 479.09 g/mol. Its IUPAC name is [7,10-dimethyl-1,4,4-tris(trimethylsilyl)-5-silaspiro[4.6]undeca-6,8,10-trien-1-yl]-trimethylsilane.
| Compound Name | [7,10-dimethyl-1,4,4-tris(trimethylsilyl)-5-silaspiro[4.6]undeca-6,8,10-trien-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101175020 |
| Molecular Formula | C24H50Si5 |
| Molecular Weight | 479.09 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | [7,10-dimethyl-1,4,4-tris(trimethylsilyl)-5-silaspiro[4.6]undeca-6,8,10-trien-1-yl]-trimethylsilane |
| SMILES | CC1=C[Si]2(C=C(C)C=C1)C([Si](C)(C)C)([Si](C)(C)C)CCC2([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C24H50Si5/c1-21-15-16-22(2)20-29(19-21)23(25(3,4)5,26(6,7)8)17-18-24(29,27(9,10)11)28(12,13)14/h15-16,19-20H,17-18H2,1-14H3 |
| InChIKey | DVNOQOIUNQKGEF-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.09 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|