C15H28Si2 — CID 553282
trimethyl-[1-(2-methylprop-1-enyl)-2-trimethylsilylcyclopenta-2,4-dien-1-yl]silane (PubChem CID 553282) has the molecular formula C15H28Si2 and a molecular weight of 264.56 g/mol. Its IUPAC name is trimethyl-[1-(2-methylprop-1-enyl)-2-trimethylsilylcyclopenta-2,4-dien-1-yl]silane.
| Compound Name | trimethyl-[1-(2-methylprop-1-enyl)-2-trimethylsilylcyclopenta-2,4-dien-1-yl]silane |
|---|---|
| PubChem CID | 553282 |
| Molecular Formula | C15H28Si2 |
| Molecular Weight | 264.56 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | trimethyl-[1-(2-methylprop-1-enyl)-2-trimethylsilylcyclopenta-2,4-dien-1-yl]silane |
| SMILES | CC(C)=CC1([Si](C)(C)C)C=CC=C1[Si](C)(C)C |
| InChI | InChI=1S/C15H28Si2/c1-13(2)12-15(17(6,7)8)11-9-10-14(15)16(3,4)5/h9-12H,1-8H3 |
| InChIKey | JTHHRYBDYNJUDH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|