C17H32Si2 — CID 553398
trimethyl-(3,3,6,7-tetramethyl-5-trimethylsilylcyclohepta-1,4,6-trien-1-yl)silane (PubChem CID 553398) has the molecular formula C17H32Si2 and a molecular weight of 292.62 g/mol. Its IUPAC name is trimethyl-(3,3,6,7-tetramethyl-5-trimethylsilylcyclohepta-1,4,6-trien-1-yl)silane.
| Compound Name | trimethyl-(3,3,6,7-tetramethyl-5-trimethylsilylcyclohepta-1,4,6-trien-1-yl)silane |
|---|---|
| PubChem CID | 553398 |
| Molecular Formula | C17H32Si2 |
| Molecular Weight | 292.62 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | trimethyl-(3,3,6,7-tetramethyl-5-trimethylsilylcyclohepta-1,4,6-trien-1-yl)silane |
| SMILES | CC1=C(C)C([Si](C)(C)C)=CC(C)(C)C=C1[Si](C)(C)C |
| InChI | InChI=1S/C17H32Si2/c1-13-14(2)16(19(8,9)10)12-17(3,4)11-15(13)18(5,6)7/h11-12H,1-10H3 |
| InChIKey | XKIVZBCIWRTIOY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.62 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|