C34H76Si8 — CID 134949816
[3,4-bis[2,2-bis(trimethylsilyl)ethenyl]-1,6,6-tris(trimethylsilyl)hexa-1,3,5-trienyl]-trimethylsilane (PubChem CID 134949816) has the molecular formula C34H76Si8 and a molecular weight of 709.67 g/mol. Its IUPAC name is [3,4-bis[2,2-bis(trimethylsilyl)ethenyl]-1,6,6-tris(trimethylsilyl)hexa-1,3,5-trienyl]-trimethylsilane.
| Compound Name | [3,4-bis[2,2-bis(trimethylsilyl)ethenyl]-1,6,6-tris(trimethylsilyl)hexa-1,3,5-trienyl]-trimethylsilane |
|---|---|
| PubChem CID | 134949816 |
| Molecular Formula | C34H76Si8 |
| Molecular Weight | 709.67 g/mol |
| Exact Mass | 708.41 |
| IUPAC Name | [3,4-bis[2,2-bis(trimethylsilyl)ethenyl]-1,6,6-tris(trimethylsilyl)hexa-1,3,5-trienyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C(=CC(C=C([Si](C)(C)C)[Si](C)(C)C)=C(C=C([Si](C)(C)C)[Si](C)(C)C)C=C([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C34H76Si8/c1-35(2,3)31(36(4,5)6)25-29(26-32(37(7,8)9)38(10,11)12)30(27-33(39(13,14)15)40(16,17)18)28-34(41(19,20)21)42(22,23)24/h25-28H,1-24H3 |
| InChIKey | SNSWTZAJVZDMLN-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.67 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|