C17H38Si4 — CID 3335332
trimethyl-[1,3,4-tris(trimethylsilyl)cyclopenta-2,4-dien-1-yl]silane (PubChem CID 3335332) has the molecular formula C17H38Si4 and a molecular weight of 354.84 g/mol. Its IUPAC name is trimethyl-[1,3,4-tris(trimethylsilyl)cyclopenta-2,4-dien-1-yl]silane.
| Compound Name | trimethyl-[1,3,4-tris(trimethylsilyl)cyclopenta-2,4-dien-1-yl]silane |
|---|---|
| PubChem CID | 3335332 |
| Molecular Formula | C17H38Si4 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | trimethyl-[1,3,4-tris(trimethylsilyl)cyclopenta-2,4-dien-1-yl]silane |
| SMILES | C[Si](C)(C)C1=CC([Si](C)(C)C)([Si](C)(C)C)C=C1[Si](C)(C)C |
| InChI | InChI=1S/C17H38Si4/c1-18(2,3)15-13-17(20(7,8)9,21(10,11)12)14-16(15)19(4,5)6/h13-14H,1-12H3 |
| InChIKey | JDTXWWPLNWPLQX-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|