C19H34Si2 — CID 553540
(7,7-dimethyl-5-trimethylsilyl-1,2,3,4-tetrahydrobenzo[7]annulen-9-yl)-trimethylsilane (PubChem CID 553540) has the molecular formula C19H34Si2 and a molecular weight of 318.65 g/mol. Its IUPAC name is (7,7-dimethyl-5-trimethylsilyl-1,2,3,4-tetrahydrobenzo[7]annulen-9-yl)-trimethylsilane.
| Compound Name | (7,7-dimethyl-5-trimethylsilyl-1,2,3,4-tetrahydrobenzo[7]annulen-9-yl)-trimethylsilane |
|---|---|
| PubChem CID | 553540 |
| Molecular Formula | C19H34Si2 |
| Molecular Weight | 318.65 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (7,7-dimethyl-5-trimethylsilyl-1,2,3,4-tetrahydrobenzo[7]annulen-9-yl)-trimethylsilane |
| SMILES | CC1(C)C=C([Si](C)(C)C)C2=C(CCCC2)C([Si](C)(C)C)=C1 |
| InChI | InChI=1S/C19H34Si2/c1-19(2)13-17(20(3,4)5)15-11-9-10-12-16(15)18(14-19)21(6,7)8/h13-14H,9-12H2,1-8H3 |
| InChIKey | ZXYAWYAZZAMYGO-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.65 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|