C18H34Si — CID 102088905
2,4-dihexyl-1,1-dimethylsilole (PubChem CID 102088905) has the molecular formula C18H34Si and a molecular weight of 278.56 g/mol. Its IUPAC name is 2,4-dihexyl-1,1-dimethylsilole.
| Compound Name | 2,4-dihexyl-1,1-dimethylsilole |
|---|---|
| PubChem CID | 102088905 |
| Molecular Formula | C18H34Si |
| Molecular Weight | 278.56 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | 2,4-dihexyl-1,1-dimethylsilole |
| SMILES | CCCCCCC1=C[Si](C)(C)C(CCCCCC)=C1 |
| InChI | InChI=1S/C18H34Si/c1-5-7-9-11-13-17-15-18(19(3,4)16-17)14-12-10-8-6-2/h15-16H,5-14H2,1-4H3 |
| InChIKey | MMHVABVVJZOJBP-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.56 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|