C18H36Si — CID 11196759
trimethyl-[(2E)-5-pentyldeca-2,4-dienyl]silane (PubChem CID 11196759) has the molecular formula C18H36Si and a molecular weight of 280.57 g/mol. Its IUPAC name is trimethyl-[(2E)-5-pentyldeca-2,4-dienyl]silane.
| Compound Name | trimethyl-[(2E)-5-pentyldeca-2,4-dienyl]silane |
|---|---|
| PubChem CID | 11196759 |
| Molecular Formula | C18H36Si |
| Molecular Weight | 280.57 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | trimethyl-[(2E)-5-pentyldeca-2,4-dienyl]silane |
| SMILES | CCCCCC(=C/C=C/C[Si](C)(C)C)CCCCC |
| InChI | InChI=1S/C18H36Si/c1-6-8-10-14-18(15-11-9-7-2)16-12-13-17-19(3,4)5/h12-13,16H,6-11,14-15,17H2,1-5H3/b13-12+ |
| InChIKey | BYRSBLXGTVNGHM-OUKQBFOZSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.57 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|