C18H26Si — CID 11425713
[(3E,5E,7E)-8-(cyclohexen-1-yl)-6-methylocta-3,5,7-trien-1-ynyl]-trimethylsilane (PubChem CID 11425713) has the molecular formula C18H26Si and a molecular weight of 270.49 g/mol. Its IUPAC name is [(3E,5E,7E)-8-(cyclohexen-1-yl)-6-methylocta-3,5,7-trien-1-ynyl]-trimethylsilane.
| Compound Name | [(3E,5E,7E)-8-(cyclohexen-1-yl)-6-methylocta-3,5,7-trien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 11425713 |
| Molecular Formula | C18H26Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | [(3E,5E,7E)-8-(cyclohexen-1-yl)-6-methylocta-3,5,7-trien-1-ynyl]-trimethylsilane |
| SMILES | CC(/C=C/C1=CCCCC1)=C\C=C\C#C[Si](C)(C)C |
| InChI | InChI=1S/C18H26Si/c1-17(11-7-6-10-16-19(2,3)4)14-15-18-12-8-5-9-13-18/h6-7,11-12,14-15H,5,8-9,13H2,1-4H3/b7-6+,15-14+,17-11+ |
| InChIKey | DNEFUELNHIRRCM-DGJPRMQZSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|