C17H23BrSi — CID 11302098
[(3E,5Z,7E)-6-bromo-8-(cyclohexen-1-yl)octa-3,5,7-trien-1-ynyl]-trimethylsilane (PubChem CID 11302098) has the molecular formula C17H23BrSi and a molecular weight of 335.36 g/mol. Its IUPAC name is [(3E,5Z,7E)-6-bromo-8-(cyclohexen-1-yl)octa-3,5,7-trien-1-ynyl]-trimethylsilane.
| Compound Name | [(3E,5Z,7E)-6-bromo-8-(cyclohexen-1-yl)octa-3,5,7-trien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 11302098 |
| Molecular Formula | C17H23BrSi |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | [(3E,5Z,7E)-6-bromo-8-(cyclohexen-1-yl)octa-3,5,7-trien-1-ynyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C#C/C=C/C=C(Br)/C=C/C1=CCCCC1 |
| InChI | InChI=1S/C17H23BrSi/c1-19(2,3)15-9-5-8-12-17(18)14-13-16-10-6-4-7-11-16/h5,8,10,12-14H,4,6-7,11H2,1-3H3/b8-5+,14-13+,17-12- |
| InChIKey | LMJFXLJYVKIFLK-ZJIXUPEMSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|