C16H28Si — CID 134993891
trimethyl-[(3E,5E)-5-methyldodeca-3,5-dien-1-ynyl]silane (PubChem CID 134993891) has the molecular formula C16H28Si and a molecular weight of 248.49 g/mol. Its IUPAC name is trimethyl-[(3E,5E)-5-methyldodeca-3,5-dien-1-ynyl]silane.
| Compound Name | trimethyl-[(3E,5E)-5-methyldodeca-3,5-dien-1-ynyl]silane |
|---|---|
| PubChem CID | 134993891 |
| Molecular Formula | C16H28Si |
| Molecular Weight | 248.49 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | trimethyl-[(3E,5E)-5-methyldodeca-3,5-dien-1-ynyl]silane |
| SMILES | CCCCCC/C=C(C)/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C16H28Si/c1-6-7-8-9-10-13-16(2)14-11-12-15-17(3,4)5/h11,13-14H,6-10H2,1-5H3/b14-11+,16-13+ |
| InChIKey | YBHVHPINPLGMHS-MWGZXAIVSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|