C15H21BrSi — CID 135075990
[(3Z,5E)-4-bromo-6-(cyclohexen-1-yl)hexa-3,5-dien-1-ynyl]-trimethylsilane (PubChem CID 135075990) has the molecular formula C15H21BrSi and a molecular weight of 309.32 g/mol. Its IUPAC name is [(3Z,5E)-4-bromo-6-(cyclohexen-1-yl)hexa-3,5-dien-1-ynyl]-trimethylsilane.
| Compound Name | [(3Z,5E)-4-bromo-6-(cyclohexen-1-yl)hexa-3,5-dien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 135075990 |
| Molecular Formula | C15H21BrSi |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | [(3Z,5E)-4-bromo-6-(cyclohexen-1-yl)hexa-3,5-dien-1-ynyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C#C/C=C(Br)/C=C/C1=CCCCC1 |
| InChI | InChI=1S/C15H21BrSi/c1-17(2,3)13-7-10-15(16)12-11-14-8-5-4-6-9-14/h8,10-12H,4-6,9H2,1-3H3/b12-11+,15-10- |
| InChIKey | YLWUUTKUCSNASN-KCSBFEQSSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|