C20H36 — CID 10934724
(5E)-7-butyl-9-methylpentadeca-5,7,8-triene (PubChem CID 10934724) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is (5E)-7-butyl-9-methylpentadeca-5,7,8-triene.
| Compound Name | (5E)-7-butyl-9-methylpentadeca-5,7,8-triene |
|---|---|
| PubChem CID | 10934724 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | (5E)-7-butyl-9-methylpentadeca-5,7,8-triene |
| SMILES | CCCC/C=C/C(=C=C(C)CCCCCC)CCCC |
| InChI | InChI=1S/C20H36/c1-5-8-11-13-15-19(4)18-20(16-10-7-3)17-14-12-9-6-2/h14,17H,5-13,15-16H2,1-4H3/b17-14+ |
| InChIKey | CVXUDVPABBPYFZ-SAPNQHFASA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|