C19H34Si — CID 15362815
[(1E)-1-[(2E)-2-hexylidenecyclohexylidene]but-3-enyl]-trimethylsilane (PubChem CID 15362815) has the molecular formula C19H34Si and a molecular weight of 290.57 g/mol. Its IUPAC name is [(1E)-1-[(2E)-2-hexylidenecyclohexylidene]but-3-enyl]-trimethylsilane.
| Compound Name | [(1E)-1-[(2E)-2-hexylidenecyclohexylidene]but-3-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 15362815 |
| Molecular Formula | C19H34Si |
| Molecular Weight | 290.57 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | [(1E)-1-[(2E)-2-hexylidenecyclohexylidene]but-3-enyl]-trimethylsilane |
| SMILES | C=CC/C(=C1/CCCC/C1=C\CCCCC)[Si](C)(C)C |
| InChI | InChI=1S/C19H34Si/c1-6-8-9-10-14-17-15-11-12-16-18(17)19(13-7-2)20(3,4)5/h7,14H,2,6,8-13,15-16H2,1,3-5H3/b17-14+,19-18+ |
| InChIKey | GKGMBUIRVJSHDS-LBEIZDTPSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.57 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|