C17H38Si4 — CID 135059316
[(Z)-2-(cyclohexen-1-yl)ethenyl]-tris(trimethylsilyl)silane (PubChem CID 135059316) has the molecular formula C17H38Si4 and a molecular weight of 354.84 g/mol. Its IUPAC name is [(Z)-2-(cyclohexen-1-yl)ethenyl]-tris(trimethylsilyl)silane.
| Compound Name | [(Z)-2-(cyclohexen-1-yl)ethenyl]-tris(trimethylsilyl)silane |
|---|---|
| PubChem CID | 135059316 |
| Molecular Formula | C17H38Si4 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | [(Z)-2-(cyclohexen-1-yl)ethenyl]-tris(trimethylsilyl)silane |
| SMILES | C[Si](C)(C)[Si](/C=C\C1=CCCCC1)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H38Si4/c1-18(2,3)21(19(4,5)6,20(7,8)9)16-15-17-13-11-10-12-14-17/h13,15-16H,10-12,14H2,1-9H3/b16-15- |
| InChIKey | QWARMRMHXBPACN-NXVVXOECSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|