C15H28Si2 — CID 553285
(3,3-dimethyl-6-trimethylsilylcyclohepta-1,4,6-trien-1-yl)-trimethylsilane (PubChem CID 553285) has the molecular formula C15H28Si2 and a molecular weight of 264.56 g/mol. Its IUPAC name is (3,3-dimethyl-6-trimethylsilylcyclohepta-1,4,6-trien-1-yl)-trimethylsilane.
| Compound Name | (3,3-dimethyl-6-trimethylsilylcyclohepta-1,4,6-trien-1-yl)-trimethylsilane |
|---|---|
| PubChem CID | 553285 |
| Molecular Formula | C15H28Si2 |
| Molecular Weight | 264.56 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (3,3-dimethyl-6-trimethylsilylcyclohepta-1,4,6-trien-1-yl)-trimethylsilane |
| SMILES | CC1(C)C=CC([Si](C)(C)C)=CC([Si](C)(C)C)=C1 |
| InChI | InChI=1S/C15H28Si2/c1-15(2)10-9-13(16(3,4)5)11-14(12-15)17(6,7)8/h9-12H,1-8H3 |
| InChIKey | AUTCHTXRSGGUFA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|