C14H26Si2 — CID 12964273
trimethyl-(6-trimethylsilylcycloocta-2,4,7-trien-1-yl)silane (PubChem CID 12964273) has the molecular formula C14H26Si2 and a molecular weight of 250.53 g/mol. Its IUPAC name is trimethyl-(6-trimethylsilylcycloocta-2,4,7-trien-1-yl)silane.
| Compound Name | trimethyl-(6-trimethylsilylcycloocta-2,4,7-trien-1-yl)silane |
|---|---|
| PubChem CID | 12964273 |
| Molecular Formula | C14H26Si2 |
| Molecular Weight | 250.53 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | trimethyl-(6-trimethylsilylcycloocta-2,4,7-trien-1-yl)silane |
| SMILES | C[Si](C)(C)C1/C=C\C=C/C([Si](C)(C)C)/C=C\1 |
| InChI | InChI=1S/C14H26Si2/c1-15(2,3)13-9-7-8-10-14(12-11-13)16(4,5)6/h7-14H,1-6H3/b9-7-,10-8-,12-11- |
| InChIKey | QRTMEQDIZAPINV-XUJPKIMESA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|