C27H59LiSi6 — CID 11060749
lithium [[3,5-bis[bis(trimethylsilyl)methyl]benzene-4-id-1-yl]-trimethylsilylmethyl]-trimethylsilane (PubChem CID 11060749) has the molecular formula C27H59LiSi6 and a molecular weight of 559.23 g/mol. Its IUPAC name is lithium [[3,5-bis[bis(trimethylsilyl)methyl]benzene-4-id-1-yl]-trimethylsilylmethyl]-trimethylsilane.
| Compound Name | lithium [[3,5-bis[bis(trimethylsilyl)methyl]benzene-4-id-1-yl]-trimethylsilylmethyl]-trimethylsilane |
|---|---|
| PubChem CID | 11060749 |
| Molecular Formula | C27H59LiSi6 |
| Molecular Weight | 559.23 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | lithium [[3,5-bis[bis(trimethylsilyl)methyl]benzene-4-id-1-yl]-trimethylsilylmethyl]-trimethylsilane |
| SMILES | C[Si](C)(C)C(c1[c-]c(C([Si](C)(C)C)[Si](C)(C)C)cc(C([Si](C)(C)C)[Si](C)(C)C)c1)[Si](C)(C)C.[Li+] |
| InChI | InChI=1S/C27H59Si6.Li/c1-28(2,3)25(29(4,5)6)22-19-23(26(30(7,8)9)31(10,11)12)21-24(20-22)27(32(13,14)15)33(16,17)18;/h19-20,25-27H,1-18H3;/q-1;+1 |
| InChIKey | GJJGFQBSOIOPJU-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.23 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|