C16H33BSi — CID 134979229
[(4E)-5-diethylboranyl-2-methylhepta-2,4-dien-4-yl]-ethyl-dimethylsilane (PubChem CID 134979229) has the molecular formula C16H33BSi and a molecular weight of 264.34 g/mol. Its IUPAC name is [(4E)-5-diethylboranyl-2-methylhepta-2,4-dien-4-yl]-ethyl-dimethylsilane.
| Compound Name | [(4E)-5-diethylboranyl-2-methylhepta-2,4-dien-4-yl]-ethyl-dimethylsilane |
|---|---|
| PubChem CID | 134979229 |
| Molecular Formula | C16H33BSi |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.24 |
| IUPAC Name | [(4E)-5-diethylboranyl-2-methylhepta-2,4-dien-4-yl]-ethyl-dimethylsilane |
| SMILES | CCB(CC)/C(CC)=C(/C=C(C)C)[Si](C)(C)CC |
| InChI | InChI=1S/C16H33BSi/c1-9-15(17(10-2)11-3)16(13-14(5)6)18(7,8)12-4/h13H,9-12H2,1-8H3/b16-15- |
| InChIKey | PVBFSXISVBCROS-NXVVXOECSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|